| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Naphthol as-mx phosphate disodium salt Basic information |
| | Naphthol as-mx phosphate disodium salt Chemical Properties |
| Melting point | >157°C (dec.) | | storage temp. | −20°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly), Water (Very Slightly) | | form | Solid | | color | Off-White to Light Yellow | | Water Solubility | water: 100mg/mL, clear to hazy | | Stability: | Hygroscopic | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C19H18NO5P.2Na/c1-12-7-8-17(13(2)9-12)20-19(21)16-10-14-5-3-4-6-15(14)11-18(16)25-26(22,23)24;;/h3-11H,1-2H3,(H,20,21)(H2,22,23,24);;/q;2*+1/p-2 | | InChIKey | IHRJBGLDOBEMPR-UHFFFAOYSA-L | | SMILES | C1(C(=O)NC2C=CC(C)=CC=2C)=CC2=C(C=CC=C2)C=C1OP([O-])([O-])=O.[Na+].[Na+] |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Naphthol as-mx phosphate disodium salt Usage And Synthesis |
| Uses | Naphthol AS-MX Phosphate Disodium Salt is a substrate for the ACP (histochemical demonstration of acid phosphatase) and TNAP (histochemical demonstration of alkaline phosphatase). Can also be used in analytical study in staining of lectin binding in muscle visualized with alk. phosphatase conjugated with avidin. Dyes and metabolites. |
| | Naphthol as-mx phosphate disodium salt Preparation Products And Raw materials |
|