| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | NAPHTHOL AS PHOSPHATE Basic information |
| Product Name: | NAPHTHOL AS PHOSPHATE | | Synonyms: | 2-HYDROXY-3-NAPHTHOIC ACID ANILIDE PHOSPHATE;3-HYDROXY-2-NAPHTHANILIDE PHOSPHATE;NAPHTHOL AS PHOSPHATE;N-PHENYL-3-(PHOSPHONOOXY)NAPHTHALENE-2-CARBOXAMIDE;NAPHTHOL AS-PHOSPHATE, FOR HISTOLOGY;NAPHTHOL AS-PHOSPHATE CRYSTALLINE;naphthol as phosphate free acid;N-Phenyl-3-phosphonooxy-2-naphthalenecarboxamide | | CAS: | 13989-98-5 | | MF: | C17H14NO5P | | MW: | 343.27 | | EINECS: | 237-789-8 | | Product Categories: | Substrates | | Mol File: | 13989-98-5.mol |  |
| | NAPHTHOL AS PHOSPHATE Chemical Properties |
| storage temp. | -20°C | | solubility | ethanol: 50mg/mL, clear, light yellow | | form | powder | | BRN | 2772810 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C17H14NO5P/c19-17(18-14-8-2-1-3-9-14)15-10-12-6-4-5-7-13(12)11-16(15)23-24(20,21)22/h1-11H,(H,18,19)(H2,20,21,22) | | InChIKey | KVIYXIWBXOQZDN-UHFFFAOYSA-N | | SMILES | OP(O)(=O)Oc1cc2ccccc2cc1C(=O)Nc3ccccc3 | | CAS DataBase Reference | 13989-98-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | NAPHTHOL AS PHOSPHATE Usage And Synthesis |
| Uses | Naphthol AS phosphate is a histochemical substrate for acid and alkaline phosphatase.Dyes and metabolites. |
| | NAPHTHOL AS PHOSPHATE Preparation Products And Raw materials |
|