Bis(n-butylcyclopentadienyl)zirconium dichloride manufacturers
|
| | Bis(n-butylcyclopentadienyl)zirconium dichloride Basic information | | storage |
| Product Name: | Bis(n-butylcyclopentadienyl)zirconium dichloride | | Synonyms: | Bis(n-butylcyclopentadienyl)zirconium(IV) dichloride, 98+%;Bis(n-butylcyclopentadienyl)zirconium dichloride,97%;Bis(n-butylcyclopent;ZirconiuM,bis[(1,2,3,4,5-h)-1-butyl-2,4-cyclopentadien-1-yl]dichloro-;Bis(n-butylcyclopentadienyl)zirconiuM dichloride SynonyMs Bis(butylcyclopentadienyl)zirconiuM(IV) dichloride;Name:bis(n-butylcyclopentadienyl)zirconium dichloride ";Dibutylzirconocene dichloride;Bis(n-butylcyclopentadienyl)zirconium dichloride, 98+% | | CAS: | 73364-10-0 | | MF: | C18H26Cl2Zr | | MW: | 404.53 | | EINECS: | 416-980-1 | | Product Categories: | metallocene;Classes of Metal Compounds;Metallocenes;Titanocene, etc.;Transition Metal Compounds;Zr (Zirconium) Compounds;Catalysis and Inorganic Chemistry;Chemical Synthesis;Zirconium | | Mol File: | 73364-10-0.mol |  |
| | Bis(n-butylcyclopentadienyl)zirconium dichloride Chemical Properties |
| Melting point | 98.7-99.4 °C(lit.) | | form | Powder | | color | off-white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Sensitive | Air & Light Sensitive | | Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3
NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 | | InChI | InChI=1S/2C9H13.2ClH.Zr/c2*1-2-3-6-9-7-4-5-8-9;;;/h2*4-5,7-8H,2-3,6H2,1H3;2*1H;/q;;;;+2/p-2 | | InChIKey | KZUKCLOWAMFDDB-UHFFFAOYSA-L | | SMILES | [C]1(CCCC)[CH][CH][CH][CH]1.[C]1(CCCC)[CH][CH][CH][CH]1.[Zr](Cl)Cl |^1:0,5,6,7,8,9,14,15,16,17| | | CAS DataBase Reference | 73364-10-0(CAS DataBase Reference) | | EPA Substance Registry System | Zirconium, bis[(1,2,3,4,5-.eta.)-1-butyl-2,4-cyclopentadien-1-yl]dichloro- (73364-10-0) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29319019 | | Storage Class | 11 - Combustible Solids |
| | Bis(n-butylcyclopentadienyl)zirconium dichloride Usage And Synthesis |
| storage | Store at room temperature. | | Chemical Properties | Bis(n-butylcyclopentadienyl)zirconium dichloride is a white crystalline powder or needles. | | Uses | Catalyst for:
- Copolymerization of ethylene-alpha-olefin
- Ethylene polymerization
Metallocene supported catalyst | | reaction suitability | core: zirconium
reagent type: catalyst
reaction type: Olefin Metathesis |
| | Bis(n-butylcyclopentadienyl)zirconium dichloride Preparation Products And Raw materials |
|