|
|
| | Buntane-2-boronic acid Basic information |
| | Buntane-2-boronic acid Chemical Properties |
| Melting point | 85-89 °C | | Boiling point | 180.0±23.0 °C(Predicted) | | density | 0.910±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 10.59±0.43(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C4H11BO2/c1-3-4(2)5(6)7/h4,6-7H,3H2,1-2H3 | | InChIKey | MACOIFNUPFKZEI-UHFFFAOYSA-N | | SMILES | B(C(C)CC)(O)O |
| | Buntane-2-boronic acid Usage And Synthesis |
| Uses | Reactant for:• ;Preparation of alkyl- and aryl quinones via silver nitrate-catalyzed coupling with quinones1• ;Preparation of arenes by coupling reactions with aryl bromides and chlorides in the presence of palladium complexes of a (pentaphenylferrocenyl)di(tert-butyl)phosphine2 | | Uses | suzuki reaction | | Purification Methods | Purify the acid by recrystallisation from *C6H6/pet ether and dry in vacuo. [McCusker et al. J Am Chem Soc 79 5179 1957, Beilstein 4 IV 4386.] |
| | Buntane-2-boronic acid Preparation Products And Raw materials |
|