| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Nitrophenylacetylene Basic information |
| Product Name: | 3-Nitrophenylacetylene | | Synonyms: | Benzene, 1-ethynyl-3-nitro- (6CI, 7CI, 8CI, 9CI);1-ETHYNYL-3-NITRO-BENZENE;Erlotinib Hydrochloride iMpurity 33;3-NITROPHENL ACETYLENE;1-(3-Nitrophenyl)ethyne;1-Nitro-3-ethynylbenzene;3-Nitrophenylacetylene 3-;Benzene, 1-ethynyl-3-nitro- | | CAS: | 3034-94-4 | | MF: | C8H5NO2 | | MW: | 147.13 | | EINECS: | 221-232-0 | | Product Categories: | pharmacetical | | Mol File: | 3034-94-4.mol |  |
| | 3-Nitrophenylacetylene Chemical Properties |
| Melting point | 27 °C | | Boiling point | 120 °C(Press: 11 Torr) | | density | 1.22±0.1 g/cm3(Predicted) | | refractive index | 1.59 | | Fp | 106.00°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | color | White to Yellow to Green | | InChI | InChI=1S/C8H5NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h1,3-6H | | InChIKey | JOUOQPWPDONKKS-UHFFFAOYSA-N | | SMILES | C1(C#C)=CC=CC([N+]([O-])=O)=C1 | | EPA Substance Registry System | 3-Nitrophenylacetylene (3034-94-4) |
| TSCA | TSCA listed | | HS Code | 2921490090 |
| | 3-Nitrophenylacetylene Usage And Synthesis |
| Uses | 3-Nitrophenylacetylene is used as a reactant in a proof-of-concept catalytic reaction to evaluate the catalytic performance of the synthesized mesoporous intermetallic compound. | | References | [1] Lv, H., Qin, H., Ariga, Prof. K., Yamauchi, Prof. Y., & Liu, Prof. B. (2022). A General Concurrent Template Strategy for Ordered Mesoporous Intermetallic Nanoparticles with Controllable Catalytic Performance. Angewandte Chemie, 134 17. https://doi.org/10.1002/ange.202116179 |
| | 3-Nitrophenylacetylene Preparation Products And Raw materials |
|