| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Fmoc-Orn(aloc)-OH Basic information |
| Product Name: | Fmoc-Orn(aloc)-OH | | Synonyms: | N-α-Boc-N-δ-allyloxycarbonyl-L-ornithine;nα-fmoc-nδ-alloc-l-ornithine;N-ALPHA-(9-FLUOROENYLMETHYLOXYCARBONYL)-N--ALLYLOXYCARBONYL-L-ORNITHINE;NDELTA-Allyloxycarbonyl-NALPHA-9-fluorenylmethoxycarbonyl-L-ornithine;Nδ-Alloc-Nα-Fmoc-L-ornithine;Nα-Fmoc-Nδ-Alloc-L-ornithine, Nδ-Alloc-Nα-Fmoc-L-ornithine;N2-(9-Fluorenylmethyloxycarbonyl)-N5-allyloxycarbonyl-L-ornithine;N2-Fmoc-N5-allyloxycarbonyl-L-ornithine | | CAS: | 147290-11-7 | | MF: | C24H26N2O6 | | MW: | 438.47 | | EINECS: | | | Product Categories: | Amino Acids;chiral | | Mol File: | 147290-11-7.mol |  |
| | Fmoc-Orn(aloc)-OH Chemical Properties |
| Boiling point | 683.9±55.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 3.85±0.21(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChIKey | RXLIOYNXBHZZBI-NRFANRHFSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(OCC=C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 147290-11-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29225090 |
| | Fmoc-Orn(aloc)-OH Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | Fmoc-Orn(aloc)-OH Preparation Products And Raw materials |
|