|
|
| | N-tert-Butoxycarbonyl-N'-benzyloxycarbonyl-L-ornithine Basic information |
| | N-tert-Butoxycarbonyl-N'-benzyloxycarbonyl-L-ornithine Chemical Properties |
| Melting point | 92.0 to 95.0 °C | | Boiling point | 579.1±50.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | pka | 3.96±0.21(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2783761 | | Major Application | peptide synthesis | | InChI | InChI=1S/C18H26N2O6/c1-18(2,3)26-17(24)20-14(15(21)22)10-7-11-19-16(23)25-12-13-8-5-4-6-9-13/h4-6,8-9,14H,7,10-12H2,1-3H3,(H,19,23)(H,20,24)(H,21,22)/t14-/m0/s1 | | InChIKey | QYYCZJUFHDLLOJ-AWEZNQCLSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(OCC1=CC=CC=C1)=O)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 2480-93-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | N-tert-Butoxycarbonyl-N'-benzyloxycarbonyl-L-ornithine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-tert-Butoxycarbonyl-N'-benzyloxycarbonyl-L-ornithine Preparation Products And Raw materials |
|