| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride Basic information | | Reaction |
| Product Name: | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride | | Synonyms: | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride;Dichloro[1,1'-bis(di-i-propylphosphino)ferrocene]palladium (II), 99%;1,1′-Bis(di-isopropylphosphino)ferrocene palladium dichloride 98%;Dichloro[1,1'-bis(di-i-propylphosphino)ferrocene]palladiuM(II),99%;1,1μ-Bis(di-isopropylphosphino)ferrocene palladium dichloride;[1,1'-Bis(diisopropylphosphino)ferrocene]dichloropalladium;Dichloro(1,1'-bis(diisopropylphosphino)ferrocene)palladium;Dichloro[Ferrocene-1,1'-diylbis(diisopropylphosphine-P)]palladium(II) | | CAS: | 215788-65-1 | | MF: | C22H30Cl2FeP2Pd | | MW: | 589.59 | | EINECS: | | | Product Categories: | Pd | | Mol File: | 215788-65-1.mol |  |
| | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride Chemical Properties |
| Melting point | 282-287 °C | | storage temp. | -20°C | | form | solid | | color | yellow-orange | | InChI | InChI=1S/2C11H15P.2ClH.Fe.Pd/c2*1-9(2)12(10(3)4)11-7-5-6-8-11;;;;/h2*9-10,12H,1-4H3;2*1H;;/q;;;;+2;/p-2 | | InChIKey | WTIDLMXGJMHQSD-UHFFFAOYSA-L | | SMILES | C(P1([Pd+2](P(C(C)C)(C(C)C)[C-]23C4=C5C6=C2[Fe+2]27893456C3C2=C7[C-]18C9=3)([Cl-])[Cl-])C(C)C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride Usage And Synthesis |
| Reaction |
- Palladium-catalyzed P-C bond formation between diphenylphosphine and ortho-substituted aryl bromides.
- Deoxygenation of pyridine N-oxides by palladium-catalyzed oxidation of trialkylamines
- Air-stable catalyst useful in challenging Suzuki coupling reactions.
| | Chemical Properties | Orange yellow crystals | | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | 1,1 bis(di-isopropylphosphine)ferrocene palladium dichloride Preparation Products And Raw materials |
|