|
|
| | DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) Basic information | | Reaction |
| Product Name: | DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) | | Synonyms: | Dichloro〔(R)-(+)-2,2-bis(diphenylphosphino)-1,1-binaphthyl)ruthenium(Ⅱ);Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1, 1'-binaphthyl]ruthenium(II), min. 95%;Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II),98% [(R)-BINAP]RuCl2;[(R)-BINAP]RUCL2;(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]dichlororuthenium(II);[(R)-(+)-2,2'-Bis-(diphenylphosphino)-1,1'-binaphthyl] ruthenium dichloride;Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]rutheniuM(II),95% [(R)-BINAP]RuCl2;(R)-[2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl]dichlororutheniuM | | CAS: | 132071-87-5 | | MF: | C44H32Cl2P2Ru | | MW: | 794.65 | | EINECS: | 623-973-9 | | Product Categories: | Ru;Catalysts for Organic Synthesis;Classes of Metal Compounds;Homogeneous Catalysts;Metal Complexes;Ru (Ruthenium) Compounds;Synthetic Organic Chemistry;Transition Metal Compounds | | Mol File: | 132071-87-5.mol | ![DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) Structure](CAS/GIF/132071-87-5.gif) |
| | DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) Chemical Properties |
| Melting point | >300 ºC | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | orange | | Sensitive | air sensitive | | InChIKey | YEKBVMDAGDTOQB-UHFFFAOYSA-L | | SMILES | C1(C2C3C=CC=CC=3C=CC=2P(C2=CC=CC=C2)C2=CC=CC=C2)C2C=CC=CC=2C=CC=1P(C1=CC=CC=C1)C1C=CC=CC=1.[Ru](Cl)Cl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | WGK 3 | | HS Code | 2931.90.6000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) Usage And Synthesis |
| Reaction |
- Enantioselective catalyst for the asymmetric hydrogenation of α,β-unsaturated olefins.
- Efficient catalyst for the asymmetric reduction of carbonyl groups, such as β-ketoesters.
| | Uses | (R)-[2,2''-Bis(diphenylphosphino)-1,1''-binaphthyl]dichlororuthenium is a catalyst used in the synthesis of helicobacter pylori lipopolysaccharide structures displaying anti-inflammatory activiy. |
| | DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II) Preparation Products And Raw materials |
|