|
|
| | L-Phenylalanine-2-d1 Basic information |
| | L-Phenylalanine-2-d1 Chemical Properties |
| Melting point | 270-275°C (dec.) (lit.) | | Boiling point | 307.500±30.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.202±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 2.210±0.10(predicted) | | form | solid | | Optical Rotation | [α]25/D -33.0°, c =1 in H2O | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i8D | | InChIKey | COLNVLDHVKWLRT-ZXEPEWCSSA-N | | SMILES | [2H][C@](N)(Cc1ccccc1)C(O)=O | | CAS Number Unlabeled | 63-91-2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Phenylalanine-2-d1 Usage And Synthesis |
| Uses | L-Phenylalanine-d is the deuterium labeled L-Phenylalanine. L-Phenylalanine ((S)-2-Amino-3-phenylpropionic acid) is an essential amino acid isolated from Escherichia coli. L-Phenylalanine is a α2δ subunit of voltage-dependent Ca+ channels antagonist with a Ki of 980 nM. L-phenylalanine is a competitive antagonist for the glycine- and glutamate-binding sites of N-methyl-D-aspartate receptors (NMDARs) (KB of 573 μM ) and non-NMDARs, respectively. L-Phenylalanine is widely used in the production of food flavors and pharmaceuticals[1][2][3][4]. | | IC 50 | NMDA Receptor | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Phenylalanine-2-d1 Preparation Products And Raw materials |
|