| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC Basic information |
| Product Name: | L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC | | Synonyms: | N-(TERT-BUTOXYCARBONYL)-L-PHENYLALANINE-ALPHA,BETA,BETA,2,3,4,5,6-D8;L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC;N-(T-BUTOXYCARBONYL)-L-PHENYLALANIN-ALPH A, BETA,BETA,2,3,4,5,6-D8, 98 ATOM % D;N-(TERT-BUTOXYCARBONYL)-L-PHENYLALANIN-ALPHA BETA BETA,2,3,4,5,6-D8;boc-phe-oh-phenyl-d5-2,3,3-d3;n-(tert-butoxycarbonyl)-l-phenyl-d5-alanine-2,3,3-d3;L-Phenyl-d5-alanine-2,3,3-d3, N-t-Boc derivative, N-(tert-Butoxycarbonyl)-L-phenyl-d5-alanine-2,3,3-d3;L-Phenyl-d5-alanine-d3-N-t-BOC | | CAS: | 106881-07-6 | | MF: | C14H11D8NO4 | | MW: | 273.35 | | EINECS: | | | Product Categories: | | | Mol File: | 106881-07-6.mol |  |
| | L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC Chemical Properties |
| Melting point | 85-87 °C(lit.) | | Boiling point | 426.619±38.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.160±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | pka | 3.881±0.10(predicted) | | Optical Rotation | [α]20/D +25°, c =1 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1/i4D,5D,6D,7D,8D,9D2,11D | | InChIKey | ZYJPUMXJBDHSIF-ZAYSQZROSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[C@]([2H])(NC(=O)OC(C)(C)C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC Usage And Synthesis |
| Uses | L-Phenyl-d5-alanine-2,3,3-d3-N-t-BOC (CAS# 106881-07-6) is a useful isotopically labeled research compound. |
| | L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC Preparation Products And Raw materials |
|