|
|
| | L-PHENYL-D5-ALANINE-2,3,3-D3 Basic information |
| Product Name: | L-PHENYL-D5-ALANINE-2,3,3-D3 | | Synonyms: | L-PHENYLALANINE (D8);L-PHENYLALANINE-ALPHA BETA BETA,2,3,4,5 6-D8;L-PHENYL-D5-ALANINE-2,3,3-D3;L-phenylalanine-alpha,beta,beta,2,3,4,5;L-PHENYLALANINE-ALPHA,BETA,BETA,2,3,4,5, 6-D8, 98 ATOM % D;l-phenylalanine-phenyl-d5-2,3,3-d3;L-Phenyl-d5-alanine-d3;[2H8]-L-Phenyl-alanine | | CAS: | 17942-32-4 | | MF: | C9H3D8NO2 | | MW: | 173.24 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N;Stable Isotopes;P;Metabolic Research;Amino AcidsStable Isotopes;Alphabetical Listings | | Mol File: | 17942-32-4.mol |  |
| | L-PHENYL-D5-ALANINE-2,3,3-D3 Chemical Properties |
| Melting point | 270-275 °C (dec.)(lit.) | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | DMSO (Slightly, Heated, Sonicated), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D -33.0°, c = 1 in H2O | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D,6D2,8D | | InChIKey | COLNVLDHVKWLRT-WYMAAGAPSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[C@]([2H])(N)C(O)=O | | CAS Number Unlabeled | 63-91-2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-PHENYL-D5-ALANINE-2,3,3-D3 Usage And Synthesis |
| Uses | L-Phenyl-d5-alanine-2,3,3-d3 is an isotope labelled compound of L-Phenylalanine (P319415). L-Phenylalanine (Aspartame EP Impurity C) is an essential amino acid. L-Phenylalanine is biologically converted into L-tyrosine, another one of the DNA-encoded amino acids, which in turn is converted to L-DOPA and further converted into dopamine, norepinephrine, and epinephrine. L-Phenylalanine is produced for medical, feed, and nutritional applications such as in the preparation of Aspartame. Neuroprotective product. | | IC 50 | NMDA Receptor |
| | L-PHENYL-D5-ALANINE-2,3,3-D3 Preparation Products And Raw materials |
|