|
|
| | 1-(4-METHOXY-PHENYL)-ETHYLAMINE Basic information |
| | 1-(4-METHOXY-PHENYL)-ETHYLAMINE Chemical Properties |
| Boiling point | 129-132 °C(Press: 25 Torr) | | density | 1.0308 g/cm3 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.29±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H13NO/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7H,10H2,1-2H3 | | InChIKey | JTDGKQNNPKXKII-UHFFFAOYSA-N | | SMILES | C1(C(N)C)C=CC(OC)=CC=1 | | CAS DataBase Reference | 6298-96-0(CAS DataBase Reference) |
| | 1-(4-METHOXY-PHENYL)-ETHYLAMINE Usage And Synthesis |
| Uses | 1-(4-methoxy-phenyl)-ethylamine is useful as chiral resolving agent, chiral auxiliary, chiral base and catalyst for asymmetric synthesis. |
| | 1-(4-METHOXY-PHENYL)-ETHYLAMINE Preparation Products And Raw materials |
|