|
|
| | BENZOYL-FVR-PNA Basic information |
| Product Name: | BENZOYL-FVR-PNA | | Synonyms: | BZ-FVR-PNA;BENZOYL-FVR-PNA;N-BENZOYL-L-PHENYLALANYL-L-VALYL-L-ARGI&;S 2160;N-benzoyl-phenylalanyl-valyl-arginine-4-nitroanilide. HCl;Bz-Phe-Val-Arg-pNA;N-Benzoyl-Phe-Val-Arg-p-nitroanilide;L-Argininamide, N-benzoyl-L-phenylalanyl-L-valyl-N-(4-nitrophenyl)- | | CAS: | 54799-93-8 | | MF: | C33H40N8O6 | | MW: | 644.72 | | EINECS: | | | Product Categories: | | | Mol File: | 54799-93-8.mol |  |
| | BENZOYL-FVR-PNA Chemical Properties |
| storage temp. | -20°C | | solubility | methanol: 10 mg/mL, clear, light yellow | | form | powder | | BRN | 3027332 | | InChIKey | PYVSMZDQQUZGPF-JAQKLANPSA-N | | SMILES | Cl.CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccccc2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)Nc3ccc(cc3)[N+]([O-])=O |
| | BENZOYL-FVR-PNA Usage And Synthesis |
| Uses |
- -Benzoyl-Phe-Val-Arg-p-nitroanilide hydrochloride has been used: as a substrate: for trypsin-like enzyme in the soluble and particulate fractions of the hyphae
- for the thrombin, recombinant and native batroxobin from snake venom
- for fibrinolytic enzyme aprE2 in amidolytic activity assay
| | General Description | N-Benzoyl-Phe-Val-Arg-p-nitroanilide is a chromogenic protease substrate. | | IC 50 | Cathepsin B |
| | BENZOYL-FVR-PNA Preparation Products And Raw materials |
|