|
|
| | 5-Bromo-4-chloro-3-indolyl alpha-D-mannopyranoside Basic information |
| | 5-Bromo-4-chloro-3-indolyl alpha-D-mannopyranoside Chemical Properties |
| Boiling point | 674℃ | | density | 1.882 | | Fp | 361℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMF: 20 mg/mL, clear, colorless to light yellow | | form | powder | | InChI | 1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11-,12+,13+,14+/m1/s1 | | InChIKey | OPIFSICVWOWJMJ-HAAGFXOZSA-N | | SMILES | OC[C@H]1O[C@H](Oc2c[nH]c3ccc(Br)c(Cl)c23)[C@@H](O)[C@@H](O)[C@@H]1O |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Bromo-4-chloro-3-indolyl alpha-D-mannopyranoside Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 5-Bromo-4-chloro-3-indolyl-α-D-mannopyranoside, 93% is a cationic surfactant commonly used in micelle experiments. | | Definition | ChEBI: 5-bromo-4-chloro-3-indolyl alpha-D-mannoside is an indolyl carbohydrate that is the alpha-D-mannoside of indoxyl in which the indole moiety is substituted at positions 4 and 5 by chlorine and bromine, respectively It has a role as a chromogenic compound. It is an organobromine compound, an organochlorine compound, an indolyl carbohydrate, a D-aldohexose derivative and an alpha-D-mannoside. It is functionally related to an indoxyl. |
| | 5-Bromo-4-chloro-3-indolyl alpha-D-mannopyranoside Preparation Products And Raw materials |
|