| Company Name: |
China Langchem Inc. Gold |
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
- IODOETHANE-D5
-
- $35.00
-
2026-09-02
- CAS:6485-58-1
- Min. Order: 1kg
- Purity: 99%
|
| | Iodoethane-d5 Basic information |
| | Iodoethane-d5 Chemical Properties |
| Melting point | -108 °C (lit.) | | Boiling point | 69-73 °C (lit.) | | density | 2.013 g/mL at 25 °C | | refractive index | n20/D 1.5091(lit.) | | Fp | 53 °C | | storage temp. | Flammables area | | solubility | Chloroform, Ethyl Acetate | | form | Oil | | color | Colourless to Light Yellow | | BRN | 1840101 | | Major Application | pharmaceutical | | InChI | InChI=1S/C2H5I/c1-2-3/h2H2,1H3 | | InChIKey | HVTICUPFWKNHNG-UHFFFAOYSA-N | | SMILES | C([H])([H])(I)C([H])([H])[H] | | CAS Number Unlabeled | 75-03-6 |
| Hazard Codes | T,Xn | | Risk Statements | 23/24/25-42/43-63-36/37/38-22 | | Safety Statements | 23-26-36/37/39-45-36/37 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | KI4750000 | | F | 1-8-10 | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Muta. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | Iodoethane-d5 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | (Iodoethane-d5) Labeled 1-Iodoethane, which is used in a variety of organic chemical reactions including the synthesis if disubstituted α-amino acids through alkylation reaction. Also used in electrochemical reduction reactions in the preparation of carbamates. | | Uses | Labeled 1-Iodoethane, which is used in a variety of organic chemical reactions including the synthesis if disubstituted α-amino acids through alkylation reaction. Also used in electrochemical reduction reactions in the preparation of carbamates. |
| | Iodoethane-d5 Preparation Products And Raw materials |
|