| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(Trifluoromethoxy)phenylmagnesium bromide Basic information |
| Product Name: | 4-(Trifluoromethoxy)phenylmagnesium bromide | | Synonyms: | 4-(Trifluoromethoxy)phenylmagnesium bromide;(4-(Trifluoromethoxy)phenyl)magnesium bromide, 0.50 M in THF;(4-(Trifluoromethoxy)phenyl)magnesium bromide, 0.50 M in 2-MeTHF;4-(Trifluoromethoxy)phenylmagnesium bromide solution
;4-(Trifluoromethoxy)phenylmagnesium bromide solution 0.5 M in THF;Magnesium, bromo[4-(trifluoromethoxy)phenyl]-;4-(Trifluoromethoxy)phenylmagnesium bromide 0.5M in 2-MeTHF;4-(Trifluoromethoxy)phenylmagnesium bromide, 0.50 M in THF - [T31805] | | CAS: | 169222-42-8 | | MF: | C7H4BrF3MgO | | MW: | 265.3102696 | | EINECS: | | | Product Categories: | Grignard Reagent;Aryl;Grignard Reagents;Organometallic Reagents | | Mol File: | 169222-42-8.mol |  |
| | 4-(Trifluoromethoxy)phenylmagnesium bromide Chemical Properties |
| density | 0.975 g/mL at 25 °C | | Fp | -30 °C | | form | liquid | | InChI | 1S/C7H4F3O.BrH.Mg/c8-7(9,10)11-6-4-2-1-3-5-6;;/h2-5H;1H;/q;;+1/p-1 | | InChIKey | UFMHNMPAQCQXMW-UHFFFAOYSA-M | | SMILES | FC(F)(F)Oc1ccc([Mg]Br)cc1 |
| Hazard Codes | F,C | | Risk Statements | 11-14-19-34-40-37 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 2924 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Flam. Liq. 2
Skin Corr. 1B
STOT SE 3 |
| | 4-(Trifluoromethoxy)phenylmagnesium bromide Usage And Synthesis |
| Uses | Reactant for:
- Preparation of chromanol derivatives as novel class of CETP inhibitors for treatment of cardiovascular disease
- Pd-catalyzed cross coupling
- Preparation of indazole-pyridine derivatives as protein kinase B/Akt inhibitors with reduced hypotension, via Stille coupling, Mitsunobu reaction and copper-catalyzed aziridine ring-opening reaction
| | reaction suitability | reaction type: Grignard Reaction |
| | 4-(Trifluoromethoxy)phenylmagnesium bromide Preparation Products And Raw materials |
|