- 2-Iodonaphthalene
-
- $0.00 / 1KG
-
2022-02-22
- CAS:612-55-5
- Min. Order: 1KG
- Purity: 98.5%
- Supply Ability: 100 tons
- 2-IODONAPHTHALENE
-
- $9.80 / 1.79999995231628KG
-
2020-01-09
- CAS:612-55-5
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | 2-IODONAPHTHALENE Basic information |
| | 2-IODONAPHTHALENE Chemical Properties |
| Melting point | 52-56 °C | | Boiling point | 320°C (rough estimate) | | density | 1.7447 (rough estimate) | | refractive index | 1.7010 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | chunks | | Appearance | Off-white to pink Solid | | BRN | 1905951 | | InChI | InChI=1S/C10H7I/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H | | InChIKey | FRNLBIWVMVNNAZ-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1I |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-IODONAPHTHALENE Usage And Synthesis |
| | 2-IODONAPHTHALENE Preparation Products And Raw materials |
|