| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | o-Xylylenebis(triphenylphosphonium bromide) Basic information |
| Product Name: | o-Xylylenebis(triphenylphosphonium bromide) | | Synonyms: | O-XYLENE BIS(TRIPHENYLPHOSPONIUM BROMIDE);[1,2-phenylenebis(methylene)]bis[triphenylphosphonium] dibromide;O-XYLYLENEBIS(TRIPHENYLPHOSPHONIUM BROMIDE), 98+%;(o-Phenylenedimethylene)bis[triphenylphosphonium bromide];1,2-Bis(triphenylphosphoniomethyl)benzene dibromide;NSC 665614;NSC 78589;triphenyl-[[2-(triphenylphosphaniumylmethyl)phenyl]methyl]phosphanium:dibromide | | CAS: | 1519-46-6 | | MF: | C44H38BrP2+ | | MW: | 708.64 | | EINECS: | 216-183-7 | | Product Categories: | C-C Bond Formation;Olefination;Wittig Reagents | | Mol File: | 1519-46-6.mol |  |
| | o-Xylylenebis(triphenylphosphonium bromide) Chemical Properties |
| Melting point | >300 °C (lit.) | | storage temp. | Store at room temperature, keep dry and cool | | Appearance | White to off-white Solid | | Sensitive | Hygroscopic | | BRN | 4121635 | | InChIKey | MXCBXCYGWQAOSN-UHFFFAOYSA-L | | SMILES | [Br-].[Br-].C(c1ccccc1C[P+](c2ccccc2)(c3ccccc3)c4ccccc4)[P+](c5ccccc5)(c6ccccc6)c7ccccc7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3278 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | o-Xylylenebis(triphenylphosphonium bromide) Usage And Synthesis |
| Uses | Reactant for:
- Synthesis of [6.8]3cyclacene and polyunsaturated [23] and [24]metacyclophanes
- Selective inclusion of equatorial isomers of cyclohexane-polyols in phosphonium salt hosts
- Photoactive platinum(II) DNA intercalator synthesis
- Preparation of (pheynlenedivinylene)bis[pyrrole] derivatives
- The reaction with sodium hexamethyldisilazide to form acyclic, ring, and cage AS,C compounds
- Synthesis of styryl substituted annelated furan derivatives
| | reaction suitability | reaction type: C-C Bond Formation |
| | o-Xylylenebis(triphenylphosphonium bromide) Preparation Products And Raw materials |
|