|
|
| | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione Basic information |
| Product Name: | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione | | Synonyms: | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione;Phenanthro[1,2-b]furan-6,10,11(7H)-trione, 8,9-dihydro-1-methyl-;Nortanshinone | | CAS: | 97399-70-7 | | MF: | C17H12O4 | | MW: | 280.27 | | EINECS: | | | Product Categories: | | | Mol File: | 97399-70-7.mol | ![8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione Structure](CAS/GIF/97399-70-7.gif) |
| | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione Chemical Properties |
| Melting point | 232-233 °C(Solv: acetone (67-64-1)) | | Boiling point | 532.2±49.0 °C(Predicted) | | density | 1.391±0.06 g/cm3(Predicted) | | form | Solid | | color | Brown to reddish brown | | InChI | InChI=1S/C17H12O4/c1-8-7-21-17-11-6-5-9-10(3-2-4-12(9)18)14(11)16(20)15(19)13(8)17/h5-7H,2-4H2,1H3 | | InChIKey | YUFZXVOYNSJPSJ-UHFFFAOYSA-N | | SMILES | O1C=C(C)C2C(=O)C(=O)C3=C(C1=2)C=CC1=C3CCCC1=O |
| | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione Usage And Synthesis |
| Uses | Nortanshinone can be used to treat bacterial infections, and can be used as an anti-inflammatory agent to protect bones. |
| | 8,9-Dihydro-1-methylphenanthro[1,2-b]furan-6,10,11(7H)-trione Preparation Products And Raw materials |
|