|
|
| | 9'''-MethyllithosperMate B Basic information |
| | 9'''-MethyllithosperMate B Chemical Properties |
| Boiling point | 992.8±65.0 °C(Predicted) | | density | 1.578±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 2.77±0.10(Predicted) | | color | Off-white to light yellow | | InChIKey | REHAMWBRZKUHPN-NQBFDTSGSA-N | | SMILES | O1C2=C(O)C=CC(/C=C/C(O[C@@H](C(O)=O)CC3=CC=C(O)C(O)=C3)=O)=C2[C@H](C(O[C@H](CC2=CC=C(O)C(O)=C2)C(OC)=O)=O)[C@H]1C1=CC=C(O)C(O)=C1 |
| | 9'''-MethyllithosperMate B Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from Salvia miltiorrhiza. | | Uses | 9''-Methyl salvianolate B is a phenolic compound isolated from Radix Salvia miltiorrhizae[1]. | | References | [1] Zeng G, et al. Identification of phenolic constituents in Radix Salvia miltiorrhizae by liquid chromatography/electrospray ionization mass spectrometry. Rapid Commun Mass Spectrom. 2006;20(3):499-506. DOI:10.1002/rcm.2332 |
| | 9'''-MethyllithosperMate B Preparation Products And Raw materials |
|