- CBZ-L-HABA
-
- $0.00 / 25KG
-
2026-01-27
- CAS:40371-50-4
- Min. Order: 2KG
- Purity: 99% up, High Density
- Supply Ability: 20 tons
|
| | (S)-N-Carbobenzyloxy-4-amino-2-hydroxybutyric acid Basic information |
| | (S)-N-Carbobenzyloxy-4-amino-2-hydroxybutyric acid Chemical Properties |
| Melting point | 75-78 °C(lit.) | | alpha | 10 º (c=1, chloroform) | | Boiling point | 396.45°C (rough estimate) | | density | 1.2499 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 3.73±0.10(Predicted) | | form | Solid | | color | White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C12H15NO5/c14-10(11(15)16)6-7-13-12(17)18-8-9-4-2-1-3-5-9/h1-5,10,14H,6-8H2,(H,13,17)(H,15,16)/t10-/m0/s1 | | InChIKey | ULKOBRDRCYROKY-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@@H](O)CCNC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 40371-50-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29242990 |
| | (S)-N-Carbobenzyloxy-4-amino-2-hydroxybutyric acid Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | (S)-(+)-Z-4-Amino-2-hydroxybutyric Acid is used in the synthesis of aminoglycoside antibiotics. |
| | (S)-N-Carbobenzyloxy-4-amino-2-hydroxybutyric acid Preparation Products And Raw materials |
|