|
|
| | 1,9-BIS(ACRYLOYLOXY)NONANE Basic information |
| Product Name: | 1,9-BIS(ACRYLOYLOXY)NONANE | | Synonyms: | NONANEDIOL DIACRYLATE;NONAMETHYLENE GLYCOL DIACRYLATE;1,9-Bis(acryloyloxy)nonane (stabilized with MEHQ);Bisacrylic acid nonamethylene ester;Diacrylic acid 1,9-nonanediyl ester;Diacrylic acid nonamethylene ester;Nonane-1,9-diol diacrylate;Nonamethylene Glycol Diacrylate
Nonanediol Diacrylate | | CAS: | 107481-28-7 | | MF: | C15H24O4 | | MW: | 268.35 | | EINECS: | 484-500-8 | | Product Categories: | Functional Monomer | | Mol File: | 107481-28-7.mol |  |
| | 1,9-BIS(ACRYLOYLOXY)NONANE Chemical Properties |
| Boiling point | 342℃ | | density | 0.981 | | refractive index | 1.4560-1.4620 | | Fp | 164 °C | | storage temp. | Amber Vial, Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colorless | | Stability: | Light Sensitive | | InChI | InChI=1S/C8H5F11O/c1-2-3(20)4(9,10)5(11,12)6(13,14)7(15,16)8(17,18)19/h2H2,1H3 | | InChIKey | PGDIJTMOHORACQ-UHFFFAOYSA-N | | SMILES | O(CCCCCCCCCOC(=O)C=C)C(=O)C=C | | EPA Substance Registry System | 2-Propenoic acid, 1,9-nonanediyl ester (107481-28-7) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2909.19.6000 | | Storage Class | 10 - Combustible liquids |
| | 1,9-BIS(ACRYLOYLOXY)NONANE Usage And Synthesis |
| | 1,9-BIS(ACRYLOYLOXY)NONANE Preparation Products And Raw materials |
|