| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
- Methylarbutin
-
- $29.00
-
2026-05-11
- CAS:6032-32-2
- Purity: 99.40%
- Supply Ability: 10g
|
| | 4-Methoxyphenyl beta-D-glucopyranoside Basic information |
| | 4-Methoxyphenyl beta-D-glucopyranoside Chemical Properties |
| Melting point | 176 °C | | Boiling point | 519℃ | | alpha | D20 -60.66° (in water) | | density | 1.427 | | Fp | 268℃ | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | Powder | | pka | 12.72±0.70(Predicted) | | color | White to Off-white | | Water Solubility | Soluble in DMSO or water | | InChI | InChI=1/C13H18O7/c1-18-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12-,13-/s3 | | InChIKey | SIXFVXJMCGPTRB-SYDLEIBONA-N | | SMILES | [C@@H]1(OC2C=CC(=CC=2)OC)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:0,11,14,16,18,r| |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-Methoxyphenyl beta-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | In cosmetics as skin lightening agent. | | Definition | ChEBI: Methylarbutin is a glycoside. |
| | 4-Methoxyphenyl beta-D-glucopyranoside Preparation Products And Raw materials |
|