|
|
| | 2-FLUORO-5-METHYLPHENOL Basic information |
| | 2-FLUORO-5-METHYLPHENOL Chemical Properties |
| Melting point | 32 °C | | Boiling point | 173 °C(lit.) | | density | 1.155 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.511(lit.) | | Fp | 153 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | liquid | | pka | 8.82±0.10(Predicted) | | color | Clear, colourless | | Specific Gravity | 1.155 | | BRN | 2433017 | | InChI | InChI=1S/C7H7FO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 | | InChIKey | XEHPMVZYZDQLDN-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C)=CC=C1F | | CAS DataBase Reference | 63762-79-8(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-21/22 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 2922 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 29081990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-FLUORO-5-METHYLPHENOL Usage And Synthesis |
| Chemical Properties | Clear yellow liquid | | Uses | 2-Fluoro-5-methylphenol may be employed as additive in various alkyne metatheses. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 33, p. 2408, 1990 DOI: 10.1021/jm00171a014 | | General Description | 2-Fluoro-5-methylphenol is a fluorinated aromatic compound. | | Synthesis | 1mmol m-methylphenol was added to 4ml of 10% aqueous acetic acid, to which 1.5mmol Selectfluor, 0.05mmol Eosin , and 0.05mmol Eosin were added.
Y, the reaction was carried out under 12W blue light irradiation at room temperature for 6 h. After the reaction, saturated NaCl aqueous solution was added to the reaction solution and extracted with dichloromethane, and the organic layer was taken through anhydrous sodium sulfate drying, filtration, and evaporation under reduced pressure, which resulted in the compound crude product. The compound crude into silica gel column chromatography, ethyl acetate and petroleum ether volume ratio of 1:9 solution as the mobile phase, TLC tracking to collect the Rf value of 0.3-0.5 eluent, collect the eluent obtained by decompression to remove the solvent, drying, to obtain the formula 2-fluoro-5-methylphenol 96mg (yield 76%). |
| | 2-FLUORO-5-METHYLPHENOL Preparation Products And Raw materials |
|