| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| Product Name: | MMB-4 | | Synonyms: | MMB-4;1,1′-Methylenebis[4-[(hydroxyimino)methyl]-pyridinium dibromide;MMB-4 >=98% (HPLC) | | CAS: | 2058-89-1 | | MF: | C13H14Br2N4O2 | | MW: | 418.08386 | | EINECS: | | | Product Categories: | | | Mol File: | 2058-89-1.mol |  |
| | MMB-4 Chemical Properties |
| Melting point | 235.0 °C | | storage temp. | 2-8°C | | solubility | H2O: soluble20mg/mL, clear | | form | powder | | color | light yellow to light brown | | Water Solubility | H2O: 20mg/mL, clear | | InChI | 1S/C13H12N4O2.2BrH/c18-14-9-12-1-5-16(6-2-12)11-17-7-3-13(4-8-17)10-15-19;;/h1-10H,11H2;2*1H | | InChIKey | ZKQNRRLCBJUEBC-UHFFFAOYSA-N | | SMILES | O/N=C/C1=CC=[N+](C[N+]2=CC=C(/C=N\O)C=C2)C=C1.[Br-].[Br-] |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral | | Toxicity | mouse,LD50,intramuscular,448mg/kg (448mg/kg),BEHAVIORAL: TREMORLUNGS, THORAX, OR RESPIRATION: RESPIRATORY STIMULATIONBEHAVIORAL: ATAXIA,National Technical Information Service. Vol. AD-A131-940, |
| | MMB-4 Usage And Synthesis |
| Uses | MMB-4 is an oxime that can reactivate cholinesterases that have been inactivated by exposure to organophosphates such as Sarin or Soman[1]. | | Biological Activity | MMB-4 is also called as 1,1μ-Methylenebis{4-[(hydroxyimino)methyl]pyridinium) dichloride. It serves as a promising antidote for organophosphate poisoning.', 'MMB-4 is an oxime th at can reactivate cholinesterases th at have been inactivated by exposure to organophosphates such as sarin or soman. Administration of MMB-4 and atropine normalizes many respiratory parameters in guinea pigs following soman inhalation. | | References | [1] Paul M Lundy, et al. Comparative protective effects of HI-6 and MMB-4 against organophosphorous nerve agent poisoning. Review Toxicology. 2011 Jul 29;285(3):90-6. DOI:10.1016/j.tox.2011.04.006 |
| | MMB-4 Preparation Products And Raw materials |
|