| Company Name: |
Heterochem |
| Tel: |
027-88041443 13072715837 |
| Email: |
sales@hetero-chem.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 5-Nitroisoindolin-1-one Basic information | | Uses |
| Product Name: | 5-Nitroisoindolin-1-one | | Synonyms: | 5-Nitro-2,3-dihydro-1H-isoindol-1-one;5-Nitro-2,3-dihydroisoindol-1-one;1H-Isoindol-1-one, 2,3-dihydro-5-nitro-;5-Nitroisoindolin-1-one | | CAS: | 876343-38-3 | | MF: | C8H6N2O3 | | MW: | 178.14 | | EINECS: | | | Product Categories: | | | Mol File: | 876343-38-3.mol |  |
| | 5-Nitroisoindolin-1-one Chemical Properties |
| Boiling point | 505.8±50.0 °C(Predicted) | | density | 1.449±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.36±0.20(Predicted) | | Appearance | Off-white to brown Solid | | InChI | InChI=1S/C8H6N2O3/c11-8-7-2-1-6(10(12)13)3-5(7)4-9-8/h1-3H,4H2,(H,9,11) | | InChIKey | CZXUANYPXDFFOG-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C([N+]([O-])=O)C=C2)CN1 |
| | 5-Nitroisoindolin-1-one Usage And Synthesis |
| Uses | 5-Nitroisoindoline-1-one is a heterocyclic derivative that can be used as an organic intermediate. | | Synthesis | 5-Nitroisoindolin-1-one can be obtained from 2-methyl-4-nitrobenzoic acid by esterifying 2-methyl-4-nitrobenzoic acid, then brominating to obtain 2-(bromomethyl)-4-nitrobenzoic acid methyl ester, and finally ring-closing. |
| | 5-Nitroisoindolin-1-one Preparation Products And Raw materials |
|