FMoc-5-fluoro-L-tryptophan manufacturers
|
| | FMoc-5-fluoro-L-tryptophan Basic information |
| Product Name: | FMoc-5-fluoro-L-tryptophan | | Synonyms: | (9H-Fluoren-9-yl)MethOxy]Carbonyl Trp(5-F)-OH;Fmoc-L-5-fluoroTryptophan;FMoc-5-fluoro-L-tryptophan;Tryptophan Impurity 11;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid;Tryptophan Impurity 27;L-Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-5-fluoro-;FMoc-5-fluoro-L-tryptophan ISO 9001：2015 REACH | | CAS: | 908846-88-8 | | MF: | C26H21FN2O4 | | MW: | 444.45 | | EINECS: | | | Product Categories: | | | Mol File: | 908846-88-8.mol |  |
| | FMoc-5-fluoro-L-tryptophan Chemical Properties |
| Melting point | 139-143 °C | | Boiling point | 713.9±60.0 °C(Predicted) | | density | 1.388±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.71±0.10(Predicted) | | Appearance | White to off-white Solid | | InChIKey | GIFXTRKMFUWKHR-DEOSSOPVSA-N | | SMILES | C(O)(=O)[C@H](CC1C2=C(C=CC(F)=C2)NC=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | FMoc-5-fluoro-L-tryptophan Usage And Synthesis |
| Uses | N-Fmoc-5-fluoro-L-tryptophan is a protected form of 5-fluoro-L-tryptophan, a compound that selectively binds to human serum albumin (HSA), the most abundant protein in the circulatory system. 5-Fluoro-L-tryptophan is also a derivative of L-Tryptophan is an amino acid that is a metabolic precursor of Norepinephrine (N674500) and Serotonin (S274980). |
| | FMoc-5-fluoro-L-tryptophan Preparation Products And Raw materials |
|