- Hydroxy-Dynasore
-
- $46.00
-
2026-07-17
- CAS:1256493-34-1
- Purity: 97.60%
- Supply Ability: 10g
|
| | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide Basic information |
| Product Name: | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide | | Synonyms: | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide;Dyngo-49;3-Hydroxy-2-naphthalenecarboxylic acid 2-[(2,4,5-trihydroxyphenyl)methylene]hydrazide;3-Hydroxy-N′-[(2,4,5-trihydroxyphenyl)methylidene]naphthalene-2-carbohydrazide;Hydroxy-Dynasore;3-Hydroxynaphthalene-2-carboxylic acid 2-[(2,4,5)-trihydroxyphenyl)methylene]hydrazide;Dyng;o-4a | | CAS: | 1256493-34-1 | | MF: | C18H14N2O5 | | MW: | 338.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1256493-34-1.mol | ![2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide Structure](CAS/20150408/GIF/1256493-34-1.gif) |
| | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide Chemical Properties |
| density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >10mg/mL | | pka | 8.28±0.40(Predicted) | | form | powder | | color | faint yellow to dark yellow | | InChI | 1S/C18H14N2O5/c21-14-8-17(24)16(23)7-12(14)9-19-20-18(25)13-5-10-3-1-2-4-11(10)6-15(13)22/h1-9,21-24H,(H,20,25)/b19-9+ | | InChIKey | UAXHPUSKEWEOAP-DJKKODMXSA-N | | SMILES | Oc1cc(O)c(\C=N\NC(=O)c2cc3ccccc3cc2O)cc1O |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide Usage And Synthesis |
| Uses | Hydroxy-Dynasore is an inhibitor of dynamin I and dynamin II. | | Definition | ChEBI: Dyngo-4a is dynamin inhibitor. It has a role as an EC 3.6.5.5 (dynamin GTPase) inhibitor. | | Biochem/physiol Actions | Hydroxy-Dynasore is a cell permeable and potent dynamin inhibitor that prevents uptake of recombinant botulinum neurotoxin A heavy chain binding domain (BoNT/A-Hc). Apparently, Hydroxy-Dynasore prevents dynamin-mediated fission of endocytic vesicles from the plasma membrane. | | in vivo | Hydroxy Dynasore (intraperitoneal injection; 30 mg/kg; 1.5-2 h before BoNT/A injection) provides protection again BoNT/A-induced paralysis in the phrenic nerve-hemidiaphragm twitch model in CD-1 mice[2]. | Animal Model: | CD-1 mice[2]. | | Dosage: | 30 mg/kg | | Administration: | Intraperitoneal injection; 1.5–2 h before BoNT/A injection | | Result: | Protected BoNT/A-induced paralysis in vivo. |
| | storage | Store at -20°C |
| | 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(2,4,5-trihydroxyphenyl)Methylene]hydrazide Preparation Products And Raw materials |
|