| Company Name: |
ChemeGen Gold
|
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Products Intro: |
Product Name:Nitrofurantoin-13C3 CAS:1217226-46-4 Purity:98% Package:10 mg;50 mg;100 mg;500 mg;1 g;5 g;10 g
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Nitrofurantoin-13C3 CAS:1217226-46-4 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Nitrofurantoin-13C3 CAS:1217226-46-4 Purity:99% Package:10mg;100mg;1g
|
Nitrofurantoin-13C3 manufacturers
|
| | Nitrofurantoin-13C3 Basic information |
| Product Name: | Nitrofurantoin-13C3 | | Synonyms: | Nitrofurantoin-13C3;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione-13C3;[13C3]-Nitrofurantoin;Nitrofurantoin 13C3Q: What is
Nitrofurantoin 13C3 Q: What is the CAS Number of
Nitrofurantoin 13C3 Q: What is the storage condition of
Nitrofurantoin 13C3 Q: What are the applications of
Nitrofurantoin 13C3;13C3-Nitrofurantoin 100 μg/ml Acetonitrile | | CAS: | 1217226-46-4 | | MF: | C8H6N4O5 | | MW: | 241.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1217226-46-4.mol |  |
| | Nitrofurantoin-13C3 Chemical Properties |
| density | 1.817±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | DMSO: slightly soluble,Methanol: slightly soluble | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3-/i4+1,6+1,8+1 | | InChIKey | NXFQHRVNIOXGAQ-QZJUDIIFSA-N | | SMILES | O=[13C]1N(/N=C\C2OC([N+](=O)[O-])=CC=2)[13CH2][13C](=O)N1 |
| | Nitrofurantoin-13C3 Usage And Synthesis |
| Uses | A nitrofuran labelled antibiotic with low resistance potential that is rapidly metabolized by mammals. Active against both Gram-positive and Gram-negative bacteria. Nitrofurantoin is also a prooxidant that is cytotoxic due to the generation of intracellular H2O2. Antibacterial.Environmental contaminants; Food contaminants; Heat processing contaminants |
| | Nitrofurantoin-13C3 Preparation Products And Raw materials |
|