| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Nitrofurazone-13C,15N2 CAS:1217220-85-3 Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Nitrofurazone-13C,15N2 CAS:1217220-85-3 Purity:98%+ Package:5g;1g;500mg;100mg;25mg;10mg
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@qq.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:Nitrofurazone-13C-15N2 CAS:1217220-85-3 Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
|
| | Nitrofurazone-13C,15N2 Basic information |
| Product Name: | Nitrofurazone-13C,15N2 | | Synonyms: | Nitrofurazone-13C,15N2;[13C,15N2]-Nitrofurazone;13C,15N2-Nitrofurazone 100 μg/ml Acetonitrile;Nitrofurazone-13C,1?N2;Nitrofurazone 13C,15N2 100 μg/mL in Acetonitrile | | CAS: | 1217220-85-3 | | MF: | C6H6N4O4 | | MW: | 201.16324 | | EINECS: | | | Product Categories: | | | Mol File: | 1217220-85-3.mol |  |
| | Nitrofurazone-13C,15N2 Chemical Properties |
| form | Solid | | color | White to yellow | | Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary | | InChI | InChI=1S/C6H6N4O4/c7-6(11)9-8-3-4-1-2-5(14-4)10(12)13/h1-3H,(H3,7,9,11)/b8-3+/i6+1,8+1,9+1 | | InChIKey | IAIWVQXQOWNYOU-LTGGZAIESA-N | | SMILES | O1C(=C([H])C([H])=C1/C(/[H])=[15N]/[15N]([H])[13C](N([H])[H])=O)[N+](=O)[O-] |
| Hazard Codes | Xn | | Risk Statements | 22-52 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 Muta. 2 Repr. 2 Skin Sens. 1 STOT RE 2 |
| | Nitrofurazone-13C,15N2 Usage And Synthesis |
| Uses | Labelled Nitrofurazone. Anti-infective (topical). Antimicrobial.Environmental contaminants; Food contaminants; Heat processing contaminants |
| | Nitrofurazone-13C,15N2 Preparation Products And Raw materials |
|