7-O-MethylrosManol manufacturers
- 7-Methoxyrosmanol
-
- $113.00
-
2026-06-01
- CAS:113085-62-4
- Purity: 98.02%
- Supply Ability: 10g
|
| | 7-O-MethylrosManol Basic information |
| Product Name: | 7-O-MethylrosManol | | Synonyms: | 7-O-MethylrosManol;7alpha-Methoxyrosmanol;7-Methylrosmanol;7-Methylrosmanol - Rosmarinus officinalis (rosemary);2H-10,4a-(Epoxymethano)phenanthren-12-one, 1,3,4,9,10,10a-hexahydro-5,6-dihydroxy-9-methoxy-1,1-dimethyl-7-(1-methylethyl)-, (4aR,9S,10S,10aS)-;7-Methylrosmanol >=95% (LC/MS-ELSD);7-Methoxyrosmanol,inhibit,Inhibitor,7Methoxyrosmanol,7 Methoxyrosmanol;7α-methoxyrosmanol | | CAS: | 113085-62-4 | | MF: | C21H28O5 | | MW: | 360.44 | | EINECS: | | | Product Categories: | | | Mol File: | 113085-62-4.mol |  |
| | 7-O-MethylrosManol Chemical Properties |
| Boiling point | 542.3±50.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 9.02±0.60(Predicted) | | form | Solid | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C21H28O5/c1-10(2)11-9-12-13(15(23)14(11)22)21-8-6-7-20(3,4)18(21)17(16(12)25-5)26-19(21)24/h9-10,16-18,22-23H,6-8H2,1-5H3/t16-,17+,18-,21-/m0/s1 | | InChIKey | XNPVHIQPSAZTLC-NYUBLWNDSA-N | | SMILES | CO[C@@H]1[C@H]2OC(=O)[C@@]3(CCCC(C)(C)[C@H]23)c4c(O)c(O)c(cc14)C(C)C |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | 7-O-MethylrosManol Usage And Synthesis |
| Uses | 7-O-Methylrosmanol is a diterpenoid rosmic acid derivative displaying antitumor effects and inducing apoptosis and G2/M arrest of neuroblastoma cells. |
| | 7-O-MethylrosManol Preparation Products And Raw materials |
|