|
|
| | 1-Caffeoylquinic acid Basic information |
| Product Name: | 1-Caffeoylquinic acid | | Synonyms: | 1-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-3,4,5-trihydroxy-,(1a,3R,4a,5R);1-Caffeoylquinic acid;3,4-Dihydroxycinnamic acid (-)-1-carboxy-3,4,5-trihydroxycyclohexyl ester;Cyclohexanecarboxylic acid, 1-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-3,4,5-trihydroxy-, (1α,3R,4α,5R)-;1-Caffeoylquinicaci;1-Kaffeylchinasaeure;1-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3,4,5-trihydroxycyclohexanecarboxylic acid;1-Caffeoylquinic acid, 10 mM in DMSO | | CAS: | 1241-87-8 | | MF: | C16H18O9 | | MW: | 354.31 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 1241-87-8.mol |  |
| | 1-Caffeoylquinic acid Chemical Properties |
| Boiling point | 636.2±55.0 °C(Predicted) | | density | 1.65 | | storage temp. | 4°C, protect from light | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 2.94±0.50(Predicted) | | color | White | | Major Application | food and beverages
pharmaceutical | | InChI | 1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(21)25-16(15(23)24)6-11(19)14(22)12(20)7-16/h1-5,11-12,14,17-20,22H,6-7H2,(H,23,24)/b4-2+/t11-,12-,14-,16+/m1/s1 | | InChIKey | GWTUHAXUUFROTF-JUHZACGLSA-N | | SMILES | O=C(/C=C/C1=CC=C(O)C(O)=C1)O[C@@]2(C(O)=O)C[C@@H](O)[C@@H](O)[C@H](O)C2 | | LogP | -0.587 (est) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Caffeoylquinic acid Usage And Synthesis |
| Chemical Properties | Earthy yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from honeysuckle. | | Uses | 1-Caffeoylquinic Acid can be useful in valorization, green extraction development, and metabolomic analysis of wild artichoke byproduct using pressurized liquid extraction UPLC-HRMS and multivariate data analysis. | | Definition | ChEBI: 1-O-caffeoylquinic acid is an alkyl caffeate ester obtained by the formal condensation of the carboxy group of trans-caffeic acid with the 1-hydroxy group of (-)-quinic acid. It has a role as a Camellia sinensis metabolite, a NF-kappaB inhibitor, an antineoplastic agent and an antioxidant. It is a quinic acid and an alkyl caffeate ester. It is functionally related to a trans-caffeic acid. It derives from a hydride of a (-)-quinic acid. | | Biological Activity | 1-Caffeoylquinic acid 1-Caffeoylquinic acid is a potent NF-κB inhibitor, showing high binding affinity to the RH domain of p105 with a Ki value of 0.002 μM and a binding energy of 1.50 Kcal/mol. 1-Caffeoylquinic acid has the ability to resist oxidative stress. 1-Caffeoylquinic acid inhibits PD-1/PD-L1 interaction. | | target | Ki: 0.002 μM (1-Caffeoylquinic acid) |
| | 1-Caffeoylquinic acid Preparation Products And Raw materials |
|