|
|
| | Ethyl 2-amino-2-phenylacetate hydrochloride Basic information |
| | Ethyl 2-amino-2-phenylacetate hydrochloride Chemical Properties |
| Melting point | 119 °C(Solv: ethanol (64-17-5)) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Methanol | | form | Solid | | color | White | | InChI | InChI=1S/C10H13NO2.ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;/h3-7,9H,2,11H2,1H3;1H | | InChIKey | FNNXQLSKQSVNLL-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)C(N)C(=O)OCC.Cl |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | Hazard Note | Irritant | | HS Code | 2916391000 |
| | Ethyl 2-amino-2-phenylacetate hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Substituted Glycine derivative. |
| | Ethyl 2-amino-2-phenylacetate hydrochloride Preparation Products And Raw materials |
|