| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- D-Phg-Oet.Hcl
-
-
2026-09-15
- CAS:17609-48-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride Basic information |
| Product Name: | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride | | Synonyms: | (R)-Ethyl 2-aMino-2-phenylacetate HCl;(S)-Ethyl 2-aMino-2-phenylacetate HCl;D-(-)-2-Phenylglycine ethyl ester hydrochloride, 98+%;D-(-)-2-Phenylglycine ethyl ester hydrochloride;H-D-Phg-OEt hydrochloride;L-phenylglyClne ethyl ester·HCl;D-(-)-ɑ-Phenylglycine ethyl ester hydrochloride;Ethyl D-Phenylglycine Ester Hydrochloride | | CAS: | 17609-48-2 | | MF: | C10H14ClNO2 | | MW: | 215.68 | | EINECS: | 241-581-2 | | Product Categories: | | | Mol File: | 17609-48-2.mol |  |
| | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride Chemical Properties |
| Melting point | 189-191°C | | storage temp. | Inert atmosphere,2-8°C | | form | Solid | | Water Solubility | Soluble in water. | | BRN | 5775455 | | InChI | InChI=1/C10H13NO2.ClH/c1-2-13-10(12)9(11)8-6-4-3-5-7-8;/h3-7,9H,2,11H2,1H3;1H/t9-;/s3 | | InChIKey | FNNXQLSKQSVNLL-OVMXBOEKNA-N | | SMILES | C1(C=CC=CC=1)[C@@H](N)C(=O)OCC.Cl |&1:6,r| | | CAS DataBase Reference | 17609-48-2(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride Usage And Synthesis |
| Uses | D-(-)-2-Phenylglycine ethyl ester hydrochloride is used in pharmaceutical intermediates, in the combination of dyestuff. |
| | D-(-)-alpha-Phenylglycine ethyl ester hydrochloride Preparation Products And Raw materials |
|