|
|
| | 6-Chloro-2-naphthylsulfonyl chloride Basic information |
| Product Name: | 6-Chloro-2-naphthylsulfonyl chloride | | Synonyms: | 6-cloro-2-naphthylsulfonylchloride;6-Chloro-2-phthylsulfonyl chloride;6-CHLOR;2-Chloro-6-naphthalenesulfonyl chloride;6-Chloronaphthalene sulfonyl chloide;6-CHLORO-2-NAPHTHYLSULFONYL CHLORIDE,99% MIN;6-CHLORO-2-NAPHTHALENESULFONYLCHLORIDE;6-Cloro-2-Naphthylsulfonyl Chlorid | | CAS: | 102153-63-9 | | MF: | C10H6Cl2O2S | | MW: | 261.12 | | EINECS: | | | Product Categories: | Naphthalene series | | Mol File: | 102153-63-9.mol |  |
| | 6-Chloro-2-naphthylsulfonyl chloride Chemical Properties |
| Melting point | 108 °C | | Boiling point | 402.9±20.0 °C(Predicted) | | density | 1.516±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Yellow | | InChI | 1S/C10H6Cl2O2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1-6H | | InChIKey | IYFIYGSJZIICOZ-UHFFFAOYSA-N | | SMILES | Clc1ccc2cc(ccc2c1)S(Cl)(=O)=O | | CAS DataBase Reference | 102153-63-9(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 6-Chloro-2-naphthylsulfonyl chloride Usage And Synthesis |
| Uses | 6-Chloro-2-naphthylsulfonyl chloride can be used as a pharmaceutical intermediate for the preparation of β-3 adrenergic receptor modulators for the prevention or treatment of heart failure-related diseases. |
| | 6-Chloro-2-naphthylsulfonyl chloride Preparation Products And Raw materials |
|