| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
3,3'-Dipropylthiacarbocyanine iodide manufacturers
|
| | 3,3'-Dipropylthiacarbocyanine iodide Basic information |
| Product Name: | 3,3'-Dipropylthiacarbocyanine iodide | | Synonyms: | 3-PROPYL-2-[3-[3-PROPYL-2(3H)BENZOTHIAZOLYLIDENE]-1-PROPENYL]BENZOTHIAZOLIUM IODIDE;3-PROPYL-2-[3-(3-PROPYL-2-BENZOTHIAZOLINYLIDENE)PROPENYL]BENZOTHIAZOLIUM IODIDE;3-PROPYL-2-((E)-3-[3-PROPYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]-1-PROPENYL)-1,3-BENZOTHIAZOL-3-IUM IODIDE;BENZOTHIAZOLIUM, 3-PROPYL-2-[3-(3-PROPYL-2(3H)-BENZOTHIAZOLYLIDENE)-1-PROPENYL]-, IODIDE;DIS-C3(3);3-Propyl-2-((1E,3Z)-3-(3-propylbenzo[d]thiazol-2(3H)-ylidene)prop-1-en-1-yl)benzo[d]thiazol-3-;3,3'-DIPROPYLTHIACARBOCYANINE IODIDE, FO R FLUORESCENCE;3,3'-DIPROPYLTHIACARBOCYANINE IODIDE, 98 % | | CAS: | 53336-12-2 | | MF: | C23H25IN2S2 | | MW: | 520.49 | | EINECS: | | | Product Categories: | | | Mol File: | 53336-12-2.mol |  |
| | 3,3'-Dipropylthiacarbocyanine iodide Chemical Properties |
| Melting point | 288 °C (dec.)(lit.) | | storage temp. | room temp | | solubility | DMF: soluble | | form | crystalline powder | | Sensitive | Light Sensitive | | λmax | 559 nm | | ε(extinction coefficient) | 163120 at 599nm in methanol at 0.00463g/L
17425 at 298nm in methanol at 0.00463g/L
40246 at 220nm in methanol at 0.00463g/L | | BRN | 3842440 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C23H25N2S2.HI/c1-3-16-24-18-10-5-7-12-20(18)26-22(24)14-9-15-23-25(17-4-2)19-11-6-8-13-21(19)27-23;/h5-15H,3-4,16-17H2,1-2H3;1H/q+1;/p-1 | | InChIKey | JGTCEHAVVINOPG-UHFFFAOYSA-M | | SMILES | [I-].CCCN1C(\Sc2ccccc12)=C\C=C\c3sc4ccccc4[n+]3CCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3'-Dipropylthiacarbocyanine iodide Usage And Synthesis |
| Uses | 3,3'-dipropyl-thiadicarbocyanine iodide is sensitive to membrane potential, fluorescence response to depolarization depends on the staining concentration and detection method. | | Uses | 3,3''-Dipropylthiacarbocyanine iodide is used to monitor changes in the cellular and mitochondrial membrane potential. | | Biological Activity | The embrane potential sensitive dye, 3,3μdipropylthiacarbocyanine iodide enters only depolarized cells, where it binds reversibly to lipid-rich intracellular components. |
| | 3,3'-Dipropylthiacarbocyanine iodide Preparation Products And Raw materials |
|