| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Fluoro-2-nitrobenzotrifluoride Basic information |
| | 5-Fluoro-2-nitrobenzotrifluoride Chemical Properties |
| Melting point | 23 °C (lit.) | | Boiling point | 198-199 °C (lit.) | | density | 1.497 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.46(lit.) | | Fp | 192 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in chloroform and methanol. | | form | clear liquid | | Specific Gravity | 1.497 | | color | Light yellow to Yellow to Orange | | BRN | 3304470 | | InChI | 1S/C7H3F4NO2/c8-4-1-2-6(12(13)14)5(3-4)7(9,10)11/h1-3H | | InChIKey | WMQOSURXFLBTPC-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(F)cc1C(F)(F)F | | CAS DataBase Reference | 393-09-9(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Fluoro-2-nitrobenzotrifluoride Usage And Synthesis |
| Chemical Properties | clear yellow liquid after melting | | Uses | 5-Fluoro-2-nitrobenzotrifluoride is a tri-substitiuted benzene derivative used in the preparation of androgen receptor modulators and other pharmaceutical compounds. | | Uses | 5-Fluoro-2-nitrobenzotrifluoride may be used as monomer in the synthesis of hyperbranched poly(aryl ether). Also used in the preparation of androgen receptor modulators and other pharmaceutical compounds. | | General Description | 5-Fluoro-2-nitrobenzotrifluoride is formed by the nitration of m-fluorobenzotrifluoride. |
| | 5-Fluoro-2-nitrobenzotrifluoride Preparation Products And Raw materials |
|