|
|
| | Tetrabutylammonium Difluorotriphenylsilicate Basic information |
| | Tetrabutylammonium Difluorotriphenylsilicate Chemical Properties |
| Melting point | 157-163 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in most organic solvents. | | form | powder to crystal | | color | White to Almost white | | Stability: | Hygroscopic, Moisture sensitive | | InChI | InChI=1S/C18H15F2Si.C16H36N/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-15H;5-16H2,1-4H3/q-1;+1 | | InChIKey | RQBKGJOQACIQDG-UHFFFAOYSA-N | | SMILES | [Si-](F)(F)(C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC=CC=1.[N+](CCCC)(CCCC)(CCCC)CCCC |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 22-26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅱ | | HS Code | 29319090 |
| | Tetrabutylammonium Difluorotriphenylsilicate Usage And Synthesis |
| Description |
Tetrabutylammonium difluorotriphenylsilicate, is a fluoride source for nucleophilic fluorination. It is an anion-exchange resin utilized in laboratory experiments for various scientific purposes. Its distinct characteristics render it useful for researchers in chromatography, catalysis, and electrochemistry. It consists of two functional groups: a positively charged ammonium group and a negatively charged difluorotriphenylsilicate group. This resin allows for the exchange of anions within solutions. In chromatography and catalysis, Tetrabutylammonium difluorotriphenylsilicate effectively separates and purifies diverse compounds, including proteins, peptides, and organic molecules. Moreover, it catalyzes organic reactions and contributes to the synthesis of organic compounds. Additionally, it plays a significant role in electrochemical experiments, aiding the study of electrochemical reactions and the measurement of electrochemical potentials.
| | Chemical Properties |
Tetrabutylammonium Difluorotriphenylsilicate(TBAT) is a liquid, degenerate exchange between TBAT and fluorotriphenylsilane (FTPS) is very rapid in THF, inherently increases in rate over time, and is profoundly sensitive to the presence of water.
| | Physical properties | mp 155–156°C(EtOAc). | | Uses | Tetrabutylammonium Difluorotriphenylsilicate is non-hygroscopic, organic-soluble reagent used as a nucleophilic fluoride source in Nucleophilic Fluorination and Allylation Reactions. | | Application |
Tetrabutylammonium Difluorotriphenylsilicate(TBAT) was introduced by DeShong in 1995 as a convenient alternative to tetra-n-butylammonium fluoride (TBAF), and is widely employed, inter alia, for C–F generation, deprotection, benzyne generation, and anion generation by Si–X cleavage (X = C, N, O, S).
| | Uses | Tetrabutylammonium Difluorotriphenylsilicate (Bardac(R) 208M) is a quaternary ammonium based antimicrobial used as a bacteriostat, deodorant, disinfectant and(or) a microbiocide. | | Preparation | Tetrabutylammonium Difluorotriphenylsilicate is prepared by treatment of triphenylsilyl fluoride
with tetrabutylammonium fluoride (TBAF), or by reaction
of triphenylsilane with tetrabutylammonium hydrogen
difluoride. |
| | Tetrabutylammonium Difluorotriphenylsilicate Preparation Products And Raw materials |
|