|
|
| | 4-Amino-5-bromo-2-chloro-benzoic acid methyl ester Basic information |
| | 4-Amino-5-bromo-2-chloro-benzoic acid methyl ester Chemical Properties |
| Boiling point | 366.9±37.0 °C(Predicted) | | density | 1.676±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | -0.65±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7BrClNO2/c1-13-8(12)4-2-5(9)7(11)3-6(4)10/h2-3H,11H2,1H3 | | InChIKey | BRWMPJAKIUAACC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(Br)=C(N)C=C1Cl |
| | 4-Amino-5-bromo-2-chloro-benzoic acid methyl ester Usage And Synthesis |
| | 4-Amino-5-bromo-2-chloro-benzoic acid methyl ester Preparation Products And Raw materials |
|