Dibenzofuran, 1-nitro-
manufacturers
|
| | Dibenzofuran, 1-nitro-
Chemical Properties |
| Melting point | 138-139 °C | | Boiling point | 379.6±15.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C12H7NO3/c14-13(15)9-5-3-7-11-12(9)8-4-1-2-6-10(8)16-11/h1-7H | | InChIKey | AMKYSWHDHALJOT-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C2=C([N+]([O-])=O)C=CC=C12 |
| | Dibenzofuran, 1-nitro-
Usage And Synthesis |
| Application | 1-Nitrodibenzofuran is an organic synthesis intermediate and a pharmaceutical intermediate that can be used in laboratory research and development processes and chemical production processes. |
| | Dibenzofuran, 1-nitro-
Preparation Products And Raw materials |
|