2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE manufacturers
|
| | 2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE Basic information |
| Product Name: | 2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE | | Synonyms: | IFLAB-BB F1371-0151;5-BROMO-2,4-DI-(TERT-BUTOXY)PYRIMIDINE;2,4-DI-T-BUTOXY-5-BROMO-PYRIMIDINE;2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE;5-broMo-2,4-bis(tert-butoxy)pyriMidine;5-BroMo-2,4-bis(1,1-diMethylethoxy)pyriMidine;5-bromo-2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidine;5-Bromo-2,4-di-(tert-butoxy)pyrimidine 95% | | CAS: | 19752-61-5 | | MF: | C12H19BrN2O2 | | MW: | 303.2 | | EINECS: | | | Product Categories: | Pyrimidines | | Mol File: | 19752-61-5.mol |  |
| | 2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE Chemical Properties |
| Melting point | 58-61°C | | Boiling point | 352.0±45.0 °C(Predicted) | | density | 1.267±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DCM, Ethyl Acetate, Methanol | | form | Solid | | pka | 1.73±0.29(Predicted) | | color | White | | InChI | InChI=1S/C12H19BrN2O2/c1-11(2,3)16-9-8(13)7-14-10(15-9)17-12(4,5)6/h7H,1-6H3 | | InChIKey | MAWUVEDTRZARNC-UHFFFAOYSA-N | | SMILES | C1(OC(C)(C)C)=NC=C(Br)C(OC(C)(C)C)=N1 |
| | 2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE Usage And Synthesis |
| Uses | 5-Bromo-2,4-bis(1,1-dimethylethoxy)pyrimidine is an intermediate in the synthesis of β-Pseudouridine (O839607), an isomer of the nucleoside uridine found in all species and in many classes of RNA except mRNA. | | Synthesis | 
5-Bromo-2,4-dichloropyrimidine (10.0 mmol, 2.28 g) is dissolved in dry THF (50 mL). Then a solution of sodium tert-butoxide (25.0 mmol, 2.40 g) in THF (100 mL) is added dropwise at rt and the reaction mixture stirred for 5 h. The reaction is quenched with water (50 mL) and extracted with EtOAc (3 x 50 mL). Purification by flash chromatography yielded the desired product 5 as colorless solid (2.79 g, 92%). 5-Bromo-2,4-di-tert-butoxypyrimidine 5 ,Yield 2.79 g, 92%. |
| | 2,4-DI-(TERT-BUTOXY)-5-BROMOPYRIMIDINE Preparation Products And Raw materials |
|