| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | N-[menthyloxycarbonyl]-L-leucine Basic information |
| | N-[menthyloxycarbonyl]-L-leucine Chemical Properties |
| Boiling point | 443.8±24.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | pka | 3.99±0.21(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C17H31NO4/c1-10(2)8-14(16(19)20)18-17(21)22-15-9-12(5)6-7-13(15)11(3)4/h10-15H,6-9H2,1-5H3,(H,18,21)(H,19,20)/t12-,13+,14-,15-/m0/s1 | | InChIKey | JDNKQMWGCKCHBF-XGUBFFRZSA-N | | SMILES | O=C(O)[C@H](CC(C)C)NC(O[C@@H]1[C@@H](C(C)C)CC[C@H](C)C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-[menthyloxycarbonyl]-L-leucine Usage And Synthesis |
| Uses | Menthol-derived mono-protected L-amino acid (MPAA) ligand is for β-arylation C-H functionalization, developed by the Jin Quan Yu group. | | reaction suitability | reaction type: C-H Activation reagent type: ligand reaction type: Peptide Synthesis |
| | N-[menthyloxycarbonyl]-L-leucine Preparation Products And Raw materials |
|