|
|
| | (+)-MENTHYL CHLOROFORMATE Basic information |
| Product Name: | (+)-MENTHYL CHLOROFORMATE | | Synonyms: | (+)-MENTHYL CHLOROFORMATE;2-isopropyl-5-Methylcyclohexyl carbonochloridate;(1S,2R,5S)-(+)-2-Isopropyl-5-methylcyclohex-1-yl chloroformate, (1S,2R,5S)-(+)-5-Methyl-2-(prop-2-yl)cyclohex-1-yl carbonochloridoate;(1S)-(+)-Menthyl chloroforMate optical purity ee: 97% (GLC);Carbonochloridic acid,5-methyl-2-(1-methylethyl)cyclohexyl ester, (1S,2R,5S)-;(+)-Menthyl chloroformate,97%;(R)-(-)-Menthyl Chloroformate;(1S)-(+)-Menthylchloroformate,97% | | CAS: | 7635-54-3 | | MF: | C11H19ClO2 | | MW: | 218.72 | | EINECS: | | | Product Categories: | chiral;Biochemistry;for Resolution of Alcohols & Thiols;for Resolution of Bases;Monocyclic Monoterpenes;Optical Resolution;Synthetic Organic Chemistry;Terpenes;Acid HalidesAsymmetric Synthesis;Chiral Resolving ReagentsDerivatization Reagents;Chiral Building Blocks;Chiral Resolution Reagents;Derivatization Reagents HPLC;Organic Building Blocks;UV-VIS | | Mol File: | 7635-54-3.mol |  |
| | (+)-MENTHYL CHLOROFORMATE Chemical Properties |
| Boiling point | 108-109 °C11 mm Hg(lit.) | | density | 1.031 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.458(lit.) | | Fp | 158 °F | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | clear liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]20/D +83°, c = 1 in chloroform | | BRN | 2414685 | | InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 | | InChIKey | KIUPCUCGVCGPPA-AEJSXWLSSA-N | | SMILES | C(Cl)(O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C)=O | | CAS DataBase Reference | 7635-54-3(CAS DataBase Reference) |
| Hazard Codes | T,C | | Risk Statements | 23-34-20/21/22 | | Safety Statements | 26-36/37/39-45-25 | | RIDADR | UN 3277 6.1/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Inhalation Skin Corr. 1B |
| | (+)-MENTHYL CHLOROFORMATE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | Chiral auxiliary in the asymmetric synthesis of quaternary carbon centers. |
| | (+)-MENTHYL CHLOROFORMATE Preparation Products And Raw materials |
|