- Fmoc-L-Cys(trt)-OH
-
-
2026-09-16
- CAS:103213-32-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Cys(Trt)-OH
-
-
2026-09-16
- CAS:103213-32-7
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
|
| | FMOC-S-trityl-L-cysteine Basic information |
| | FMOC-S-trityl-L-cysteine Chemical Properties |
| Melting point | 170-173 °C(lit.) | | alpha | 16 º (c=1, THF) | | Boiling point | 763.4±60.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | refractive index | 18 ° (C=1, THF) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.70±0.10(Predicted) | | form | Powder | | color | White to almost white | | Optical Rotation | [α]20/D +16.0±2°, c = 1% in THF | | Water Solubility | Insoluble in water. Soluble in most organic solvents. | | BRN | 4221286 | | Major Application | peptide synthesis | | InChIKey | KLBPUVPNPAJWHZ-UMSFTDKQSA-N | | SMILES | OC(=O)[C@H](CSC(c1ccccc1)(c2ccccc2)c3ccccc3)NC(=O)OCC4c5ccccc5-c6ccccc46 | | CAS DataBase Reference | 103213-32-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-26 | | WGK Germany | 3 | | F | 9-21 | | Hazard Note | Irritant | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-S-trityl-L-cysteine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Fmoc-Cys(Trt)-OH is an N-terminal protected cysteine derivative used in peptide synthesis. Some of the examples are:
- Synthesis of mono- and bi-functionalized platinum(IV) complexes to target angiogenic tumor vasculature.
- Synthesis of proteins through native chemical ligation of peptide hydrazides as thioester surrogates via solid-phase synthesis.
- Synthesis of glycoconjugates by conjugating reducing sugars to cysteine residues of peptides.
| | Uses |
FMOC-S-trityl-L-cysteine is potentially useful for proteomics studies, and solid phase peptide synthesis techniques. The compound could be useful as an unusual amino acid analog to aid in the deconvolution of protein structure and function.
| | General Description | The standard derivative for Fmoc SPPS of peptides containing Cys [1]. The Trt group is removed with 95% TFA containing 1-5% TIS. Ideally, this derivative should be introduced using the symmetrical anhydride or DIPCDI/HOBt activation [2,3] to minimize enantiomerization. If activation with uronium or phosphonium reagents, such as HBTU or PyBOP®, is to be employed, it is strongly recommended that collidine is used as the base [4], as this has been shown to significantly reduce loss of optical integrity during coupling. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-S-trityl-L-cysteine Preparation Products And Raw materials |
|