Tetramethylammonium hydrogensulfate manufacturers
|
| | Tetramethylammonium hydrogensulfate Basic information |
| Product Name: | Tetramethylammonium hydrogensulfate | | Synonyms: | Tetramethylammonium hydrogensulfate (for ion pair chromatography)≥99%;Tetramethylammonium hydrogen sulfate for ion pair chromatography LiChropur;Tetraethylammonium bisulfate hydrate;TETRAMETHYL AMMONIUM HYDROGEN SULPHATE;TETRAMETHYLAMMONIUM HYDROGEN SULFATE CON C., PGE W. 6 AMP.;TETRAMETHYLAMMONIUM HYDROGENSULFATE, ION -PAIR REAG, 99+% (FLUKA 87724);Tetramethylammonium hydrogensulfate, HPLC grade, 99+%;Methanaminium, N,N,N-trimethyl-, sulfate (1:1) | | CAS: | 80526-82-5 | | MF: | C4H13NO4S | | MW: | 171.22 | | EINECS: | 279-490-5 | | Product Categories: | Ammonium Polyhalides, etc. (Quaternary);Quaternary Ammonium Compounds | | Mol File: | 80526-82-5.mol |  |
| | Tetramethylammonium hydrogensulfate Chemical Properties |
| Melting point | 295-297 °C | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | almost transparency in Water | | form | Powder | | color | White to off-white | | Odor | Odorless | | λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.04 λ: 230 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 | | BRN | 4829202 | | InChI | InChI=1S/C4H12N.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-1 | | InChIKey | DWTYPCUOWWOADE-UHFFFAOYSA-M | | SMILES | [N+](C)(C)(C)C.[O-]S(O)(=O)=O | | CAS DataBase Reference | 80526-82-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | F | 3 | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids |
| | Tetramethylammonium hydrogensulfate Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Tetramethylammonium hydrogensulfate, sometimes abbreviated as TMAHS, is a quaternary ammonium salt commonly used as a catalyst and phase transfer agent in chemical reactions, especially in organic synthesis. In addition, it is used as an electrolyte additive in electrochemical and rechargeable batteries. TMAHSs have also been investigated for their potential use in various applications such as wastewater treatment, gas separation, and fuel cells. |
| | Tetramethylammonium hydrogensulfate Preparation Products And Raw materials |
|