|
|
| | 3-(4-HYDROXYPHENYL)PROPIONITRILE Basic information |
| | 3-(4-HYDROXYPHENYL)PROPIONITRILE Chemical Properties |
| Melting point | 56-58°C | | Boiling point | 166°C 8mm | | density | 1.127±0.06 g/cm3(Predicted) | | Fp | 166°C/8mm | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 9.88±0.15(Predicted) | | color | White to Pale Yellow | | Water Solubility | Insoluble in water. | | BRN | 1448680 | | InChI | InChI=1S/C9H9NO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2H2 | | InChIKey | KDMJGLYRWRHKJS-UHFFFAOYSA-N | | SMILES | C1(CCC#N)=CC=C(O)C=C1 | | CAS DataBase Reference | 17362-17-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(4-Hydroxyphenyl)propionitrile(17362-17-3) |
| Provider | Language |
|
ALFA
| English |
| | 3-(4-HYDROXYPHENYL)PROPIONITRILE Usage And Synthesis |
| Uses | 3-(4-Hydroxyphenyl)propionitrile is commonly used as a tool to evaluate the biological role of ERβ. |
| | 3-(4-HYDROXYPHENYL)PROPIONITRILE Preparation Products And Raw materials |
|