| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-(R)-3-amino-3-(4-hydroxy-phenyl)-propionic acid Basic information |
| | Boc-(R)-3-amino-3-(4-hydroxy-phenyl)-propionic acid Chemical Properties |
| Boiling point | 476.7±40.0 °C(Predicted) | | density | 1.236±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 4.41±0.10(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C14H19NO5/c1-14(2,3)20-13(19)15-11(8-12(17)18)9-4-6-10(16)7-5-9/h4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18)/t11-/m1/s1 | | InChIKey | VHBNWQLIRVDMMR-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)c1ccc(O)cc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-(R)-3-amino-3-(4-hydroxy-phenyl)-propionic acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-(R)-3-amino-3-(4-hydroxy-phenyl)-propionic acid Preparation Products And Raw materials |
|