- 3-Bromo-2-fluorotoluene
-
- $0.00 / 1g
-
2026-02-02
- CAS:59907-12-9
- Min. Order: 50mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
|
| | 3-Bromo-2-fluorotoluene Basic information |
| | 3-Bromo-2-fluorotoluene Chemical Properties |
| Boiling point | 186 °C | | density | 1.52 | | refractive index | n20/D 1.533 | | Fp | 76°C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C7H6BrF/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 | | InChIKey | LZVNGSFAHGKCDM-UHFFFAOYSA-N | | SMILES | C1(C(F)=C(C)C=CC=1)Br | | CAS DataBase Reference | 59907-12-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Bromo-2-fluorotoluene Usage And Synthesis |
| Chemical Properties | light yellow liquid |
| | 3-Bromo-2-fluorotoluene Preparation Products And Raw materials |
|