|
|
| | alpha-Hydroxymetoprolol Basic information |
| | alpha-Hydroxymetoprolol Chemical Properties |
| Melting point | 65-67°C | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | color | Off-White to Light Beige | | BRN | 6571082 | | Major Application | forensics and toxicology pharmaceutical (small molecule) | | InChI | InChI=1S/C15H25NO4/c1-11(2)16-8-13(17)9-20-14-6-4-12(5-7-14)15(18)10-19-3/h4-7,11,13,15-18H,8-10H2,1-3H3 | | InChIKey | OFRYBPCSEMMZHR-UHFFFAOYSA-N | | SMILES | C1(C(O)COC)C=CC(OCC(O)CNC(C)C)=CC=1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | alpha-Hydroxymetoprolol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Metoprolol. | | Definition | ChEBI: Alpha-Hydroxymetoprolol is an aromatic ether. |
| | alpha-Hydroxymetoprolol Preparation Products And Raw materials |
|